C10H12Cl2N2O4S — CID 174846366
3,4-bis(2-chloroethyl)-2-nitrobenzenesulfonamide (PubChem CID 174846366) has the molecular formula C10H12Cl2N2O4S and a molecular weight of 327.19 g/mol. Its IUPAC name is 3,4-bis(2-chloroethyl)-2-nitrobenzenesulfonamide.
| Compound Name | 3,4-bis(2-chloroethyl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 174846366 |
| Molecular Formula | C10H12Cl2N2O4S |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 3,4-bis(2-chloroethyl)-2-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCCl)c(CCCl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12Cl2N2O4S/c11-5-3-7-1-2-9(19(13,17)18)10(14(15)16)8(7)4-6-12/h1-2H,3-6H2,(H2,13,17,18) |
| InChIKey | PTTDUGXNADORRQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|