C24H32N4O13S2 — CID 86740531
[3-[4-(3-butoxy-2-hydroxypropoxy)anilino]-3-oxopropyl]-dimethylsulfanium;2,4,6-trinitrobenzenesulfonate (PubChem CID 86740531) has the molecular formula C24H32N4O13S2 and a molecular weight of 648.67 g/mol. Its IUPAC name is [3-[4-(3-butoxy-2-hydroxypropoxy)anilino]-3-oxopropyl]-dimethylsulfanium;2,4,6-trinitrobenzenesulfonate.
| Compound Name | [3-[4-(3-butoxy-2-hydroxypropoxy)anilino]-3-oxopropyl]-dimethylsulfanium;2,4,6-trinitrobenzenesulfonate |
|---|---|
| PubChem CID | 86740531 |
| Molecular Formula | C24H32N4O13S2 |
| Molecular Weight | 648.67 g/mol |
| Exact Mass | 648.14 |
| IUPAC Name | [3-[4-(3-butoxy-2-hydroxypropoxy)anilino]-3-oxopropyl]-dimethylsulfanium;2,4,6-trinitrobenzenesulfonate |
| SMILES | CCCCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.O=[N+]([O-])c1cc([N+](=O)[O-])c(S(=O)(=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H29NO4S.C6H3N3O9S/c1-4-5-11-22-13-16(20)14-23-17-8-6-15(7-9-17)19-18(21)10-12-24(2)3;10-7(11)3-1-4(8(12)13)6(19(16,17)18)5(2-3)9(14)15/h6-9,16,20H,4-5,10-14H2,1-3H3;1-2H,(H,16,17,18) |
| InChIKey | PAYAGUVJZFSZQQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 254.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.67 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|