C25H37NO7S2 — CID 10530184
[3-[4-(2,3-diethoxypropoxy)anilino]-3-oxopropyl]-dimethylsulfanium;4-methylbenzenesulfonate (PubChem CID 10530184) has the molecular formula C25H37NO7S2 and a molecular weight of 527.71 g/mol. Its IUPAC name is [3-[4-(2,3-diethoxypropoxy)anilino]-3-oxopropyl]-dimethylsulfanium;4-methylbenzenesulfonate.
| Compound Name | [3-[4-(2,3-diethoxypropoxy)anilino]-3-oxopropyl]-dimethylsulfanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10530184 |
| Molecular Formula | C25H37NO7S2 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | [3-[4-(2,3-diethoxypropoxy)anilino]-3-oxopropyl]-dimethylsulfanium;4-methylbenzenesulfonate |
| SMILES | CCOCC(COc1ccc(NC(=O)CC[S+](C)C)cc1)OCC.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C18H29NO4S.C7H8O3S/c1-5-21-13-17(22-6-2)14-23-16-9-7-15(8-10-16)19-18(20)11-12-24(3)4;1-6-2-4-7(5-3-6)11(8,9)10/h7-10,17H,5-6,11-14H2,1-4H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | NRLZOTACRQXSQF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|