C18H28NO5S+ — CID 100916341
[3-[4-[(2S)-2-acetyloxy-3-ethoxypropoxy]anilino]-3-oxopropyl]-dimethylsulfanium (PubChem CID 100916341) has the molecular formula C18H28NO5S+ and a molecular weight of 370.49 g/mol. Its IUPAC name is [3-[4-[(2S)-2-acetyloxy-3-ethoxypropoxy]anilino]-3-oxopropyl]-dimethylsulfanium.
| Compound Name | [3-[4-[(2S)-2-acetyloxy-3-ethoxypropoxy]anilino]-3-oxopropyl]-dimethylsulfanium |
|---|---|
| PubChem CID | 100916341 |
| Molecular Formula | C18H28NO5S+ |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | [3-[4-[(2S)-2-acetyloxy-3-ethoxypropoxy]anilino]-3-oxopropyl]-dimethylsulfanium |
| SMILES | CCOC[C@@H](COc1ccc(NC(=O)CC[S+](C)C)cc1)OC(C)=O |
| InChI | InChI=1S/C18H27NO5S/c1-5-22-12-17(24-14(2)20)13-23-16-8-6-15(7-9-16)19-18(21)10-11-25(3)4/h6-9,17H,5,10-13H2,1-4H3/p+1/t17-/m0/s1 |
| InChIKey | IMLXTJYQZUHJLK-KRWDZBQOSA-O |
| XLogP | 2.24 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|