C16H26NO4S+ — CID 10815218
[3-[4-(2,3-dimethoxypropoxy)anilino]-3-oxopropyl]-dimethylsulfanium (PubChem CID 10815218) has the molecular formula C16H26NO4S+ and a molecular weight of 328.45 g/mol. Its IUPAC name is [3-[4-(2,3-dimethoxypropoxy)anilino]-3-oxopropyl]-dimethylsulfanium.
| Compound Name | [3-[4-(2,3-dimethoxypropoxy)anilino]-3-oxopropyl]-dimethylsulfanium |
|---|---|
| PubChem CID | 10815218 |
| Molecular Formula | C16H26NO4S+ |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | [3-[4-(2,3-dimethoxypropoxy)anilino]-3-oxopropyl]-dimethylsulfanium |
| SMILES | COCC(COc1ccc(NC(=O)CC[S+](C)C)cc1)OC |
| InChI | InChI=1S/C16H25NO4S/c1-19-11-15(20-2)12-21-14-7-5-13(6-8-14)17-16(18)9-10-22(3)4/h5-8,15H,9-12H2,1-4H3/p+1 |
| InChIKey | LKJTVQKBTDLKER-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|