C18H31N2O3+ — CID 101214480
[3-[4-(2-hydroxyhexoxy)anilino]-3-oxopropyl]-trimethylazanium (PubChem CID 101214480) has the molecular formula C18H31N2O3+ and a molecular weight of 323.46 g/mol. Its IUPAC name is [3-[4-(2-hydroxyhexoxy)anilino]-3-oxopropyl]-trimethylazanium.
| Compound Name | [3-[4-(2-hydroxyhexoxy)anilino]-3-oxopropyl]-trimethylazanium |
|---|---|
| PubChem CID | 101214480 |
| Molecular Formula | C18H31N2O3+ |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | [3-[4-(2-hydroxyhexoxy)anilino]-3-oxopropyl]-trimethylazanium |
| SMILES | CCCCC(O)COc1ccc(NC(=O)CC[N+](C)(C)C)cc1 |
| InChI | InChI=1S/C18H30N2O3/c1-5-6-7-16(21)14-23-17-10-8-15(9-11-17)19-18(22)12-13-20(2,3)4/h8-11,16,21H,5-7,12-14H2,1-4H3/p+1 |
| InChIKey | UDLXJOQHUSXQIU-UHFFFAOYSA-O |
| XLogP | 2.65 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|