C8H8ClNO3 — CID 23238949
4-chloro-2,3-dimethyl-6-nitrophenol (PubChem CID 23238949) has the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. Its IUPAC name is 4-chloro-2,3-dimethyl-6-nitrophenol.
| Compound Name | 4-chloro-2,3-dimethyl-6-nitrophenol |
|---|---|
| PubChem CID | 23238949 |
| Molecular Formula | C8H8ClNO3 |
| Molecular Weight | 201.61 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | 4-chloro-2,3-dimethyl-6-nitrophenol |
| SMILES | Cc1c(Cl)cc([N+](=O)[O-])c(O)c1C |
| InChI | InChI=1S/C8H8ClNO3/c1-4-5(2)8(11)7(10(12)13)3-6(4)9/h3,11H,1-2H3 |
| InChIKey | CFRHQFGPONDFPG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.61 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|