C14H13ClN4O7 — CID 131886524
4-chloro-2,5-dimethylaniline;2,4,6-trinitrophenol (PubChem CID 131886524) has the molecular formula C14H13ClN4O7 and a molecular weight of 384.73 g/mol. Its IUPAC name is 4-chloro-2,5-dimethylaniline;2,4,6-trinitrophenol.
| Compound Name | 4-chloro-2,5-dimethylaniline;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 131886524 |
| Molecular Formula | C14H13ClN4O7 |
| Molecular Weight | 384.73 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 4-chloro-2,5-dimethylaniline;2,4,6-trinitrophenol |
| SMILES | Cc1cc(Cl)c(C)cc1N.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H10ClN.C6H3N3O7/c1-5-4-8(10)6(2)3-7(5)9;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h3-4H,10H2,1-2H3;1-2,10H |
| InChIKey | WOSGELCXLHVHBI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 175.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.73 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|