C14H9ClN2O6S — CID 16750339
3-chloro-5-(3,4-dihydroxy-5-nitrophenyl)sulfonyl-4-methylbenzonitrile (PubChem CID 16750339) has the molecular formula C14H9ClN2O6S and a molecular weight of 368.75 g/mol. Its IUPAC name is 3-chloro-5-(3,4-dihydroxy-5-nitrophenyl)sulfonyl-4-methylbenzonitrile.
| Compound Name | 3-chloro-5-(3,4-dihydroxy-5-nitrophenyl)sulfonyl-4-methylbenzonitrile |
|---|---|
| PubChem CID | 16750339 |
| Molecular Formula | C14H9ClN2O6S |
| Molecular Weight | 368.75 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 3-chloro-5-(3,4-dihydroxy-5-nitrophenyl)sulfonyl-4-methylbenzonitrile |
| SMILES | Cc1c(Cl)cc(C#N)cc1S(=O)(=O)c1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H9ClN2O6S/c1-7-10(15)2-8(6-16)3-13(7)24(22,23)9-4-11(17(20)21)14(19)12(18)5-9/h2-5,18-19H,1H3 |
| InChIKey | OYOJHBMAPRRWJC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 141.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.75 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|