C14H5ClN6O8 — CID 89389493
2-chloro-3,5-dinitrobenzonitrile;3,5-dinitrobenzonitrile (PubChem CID 89389493) has the molecular formula C14H5ClN6O8 and a molecular weight of 420.68 g/mol. Its IUPAC name is 2-chloro-3,5-dinitrobenzonitrile;3,5-dinitrobenzonitrile.
| Compound Name | 2-chloro-3,5-dinitrobenzonitrile;3,5-dinitrobenzonitrile |
|---|---|
| PubChem CID | 89389493 |
| Molecular Formula | C14H5ClN6O8 |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | 2-chloro-3,5-dinitrobenzonitrile;3,5-dinitrobenzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.N#Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C7H2ClN3O4.C7H3N3O4/c8-7-4(3-9)1-5(10(12)13)2-6(7)11(14)15;8-4-5-1-6(9(11)12)3-7(2-5)10(13)14/h1-2H;1-3H |
| InChIKey | WMRCAXIXHHNVFL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 220.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|