C7HCl2N3O4 — CID 154236492
2,6-dichloro-3,5-dinitrobenzonitrile (PubChem CID 154236492) has the molecular formula C7HCl2N3O4 and a molecular weight of 262.01 g/mol. Its IUPAC name is 2,6-dichloro-3,5-dinitrobenzonitrile.
| Compound Name | 2,6-dichloro-3,5-dinitrobenzonitrile |
|---|---|
| PubChem CID | 154236492 |
| Molecular Formula | C7HCl2N3O4 |
| Molecular Weight | 262.01 g/mol |
| Exact Mass | 260.93 |
| IUPAC Name | 2,6-dichloro-3,5-dinitrobenzonitrile |
| SMILES | N#Cc1c(Cl)c([N+](=O)[O-])cc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C7HCl2N3O4/c8-6-3(2-10)7(9)5(12(15)16)1-4(6)11(13)14/h1H |
| InChIKey | AILZELNZMCLRSA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 110.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.01 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|