C9H3ClN4O4 — CID 21189950
6-chloro-7-nitro-2,3-dioxo-1,4-dihydroquinoxaline-5-carbonitrile (PubChem CID 21189950) has the molecular formula C9H3ClN4O4 and a molecular weight of 266.60 g/mol. Its IUPAC name is 6-chloro-7-nitro-2,3-dioxo-1,4-dihydroquinoxaline-5-carbonitrile.
| Compound Name | 6-chloro-7-nitro-2,3-dioxo-1,4-dihydroquinoxaline-5-carbonitrile |
|---|---|
| PubChem CID | 21189950 |
| Molecular Formula | C9H3ClN4O4 |
| Molecular Weight | 266.60 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 6-chloro-7-nitro-2,3-dioxo-1,4-dihydroquinoxaline-5-carbonitrile |
| SMILES | N#Cc1c(Cl)c([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C9H3ClN4O4/c10-6-3(2-11)7-4(1-5(6)14(17)18)12-8(15)9(16)13-7/h1H,(H,12,15)(H,13,16) |
| InChIKey | FGKQPVBBUINHMW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 132.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.60 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|