About 6-chloro-7-nitro-2,3-dioxo-1,4-dihydroquinoxaline-5-carbonitrile
6-chloro-7-nitro-2,3-dioxo-1,4-dihydroquinoxaline-5-carbonitrile (PubChem CID 21189950) has the molecular formula C9H3ClN4O4
and a molecular weight of 266.60 g/mol. Its IUPAC name is 6-chloro-7-nitro-2,3-dioxo-1,4-dihydroquinoxaline-5-carbonitrile.
Molecular Properties
| Compound Name | 6-chloro-7-nitro-2,3-dioxo-1,4-dihydroquinoxaline-5-carbonitrile |
| PubChem CID | 21189950 |
| Molecular Formula | C9H3ClN4O4 |
| Molecular Weight | 266.60 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 6-chloro-7-nitro-2,3-dioxo-1,4-dihydroquinoxaline-5-carbonitrile |
| SMILES | N#Cc1c(Cl)c([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C9H3ClN4O4/c10-6-3(2-11)7-4(1-5(6)14(17)18)12-8(15)9(16)13-7/h1H,(H,12,15)(H,13,16) |
| InChIKey | FGKQPVBBUINHMW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 132.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.60 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-7-nitro-2,3-dioxo-1,4-dihydroquinoxaline-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-7-nitro-2,3-dioxo-1,4-dihydroquinoxaline-5-carbonitrile?
The IUPAC name of 6-chloro-7-nitro-2,3-dioxo-1,4-dihydroquinoxaline-5-carbonitrile (CID 21189950) is 6-chloro-7-nitro-2,3-dioxo-1,4-dihydroquinoxaline-5-carbonitrile.
What is the SMILES notation for 6-chloro-7-nitro-2,3-dioxo-1,4-dihydroquinoxaline-5-carbonitrile?
The canonical SMILES for 6-chloro-7-nitro-2,3-dioxo-1,4-dihydroquinoxaline-5-carbonitrile is N#Cc1c(Cl)c([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12.
What is the InChIKey of 6-chloro-7-nitro-2,3-dioxo-1,4-dihydroquinoxaline-5-carbonitrile?
The InChIKey is FGKQPVBBUINHMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3ClN4O4/c10-6-3(2-11)7-4(1-5(6)14(17)18)12-8(15)9(16)13-7/h1H,(H,12,15)(H,13,16).
What are the key properties of 6-chloro-7-nitro-2,3-dioxo-1,4-dihydroquinoxaline-5-carbonitrile?
6-chloro-7-nitro-2,3-dioxo-1,4-dihydroquinoxaline-5-carbonitrile has a molecular weight of 266.60 g/mol, XLogP of 0.65, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-7-nitro-2,3-dioxo-1,4-dihydroquinoxaline-5-carbonitrile is sourced from PubChem (CID 21189950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).