C8H3FN4O6 — CID 21189952
6-fluoro-5,7-dinitro-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 21189952) has the molecular formula C8H3FN4O6 and a molecular weight of 270.13 g/mol. Its IUPAC name is 6-fluoro-5,7-dinitro-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-fluoro-5,7-dinitro-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 21189952 |
| Molecular Formula | C8H3FN4O6 |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 6-fluoro-5,7-dinitro-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2cc([N+](=O)[O-])c(F)c([N+](=O)[O-])c2[nH]c1=O |
| InChI | InChI=1S/C8H3FN4O6/c9-4-3(12(16)17)1-2-5(6(4)13(18)19)11-8(15)7(14)10-2/h1H,(H,10,14)(H,11,15) |
| InChIKey | DSZQPBJBGARVAP-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 152.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|