C12H6N4O6S+2 — CID 146015354
6-nitro-2,3-dioxo-1,4,8,10-tetrahydrobenzo[f]quinoxaline-8,10-diylium-7-sulfonamide (PubChem CID 146015354) has the molecular formula C12H6N4O6S+2 and a molecular weight of 334.27 g/mol. Its IUPAC name is 6-nitro-2,3-dioxo-1,4,8,10-tetrahydrobenzo[f]quinoxaline-8,10-diylium-7-sulfonamide.
| Compound Name | 6-nitro-2,3-dioxo-1,4,8,10-tetrahydrobenzo[f]quinoxaline-8,10-diylium-7-sulfonamide |
|---|---|
| PubChem CID | 146015354 |
| Molecular Formula | C12H6N4O6S+2 |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 6-nitro-2,3-dioxo-1,4,8,10-tetrahydrobenzo[f]quinoxaline-8,10-diylium-7-sulfonamide |
| SMILES | NS(=O)(=O)C1=[C+]C=[C+]c2c1c([N+](=O)[O-])cc1[nH]c(=O)c(=O)[nH]c21 |
| InChI | InChI=1S/C12H4N4O6S/c13-23(21,22)8-3-1-2-5-9(8)7(16(19)20)4-6-10(5)15-12(18)11(17)14-6/h1,4H,(H2-2,13,14,15,17,18,21,22)/p+2 |
| InChIKey | QVVKYPTUYHAFCW-UHFFFAOYSA-P |
| XLogP | -0.72 |
| TPSA | 169.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|