C6H5F2N3O5S — CID 133102990
3-(difluoromethyl)-5-nitro-6-oxo-1H-pyridine-2-sulfonamide (PubChem CID 133102990) has the molecular formula C6H5F2N3O5S and a molecular weight of 269.19 g/mol. Its IUPAC name is 3-(difluoromethyl)-5-nitro-6-oxo-1H-pyridine-2-sulfonamide.
| Compound Name | 3-(difluoromethyl)-5-nitro-6-oxo-1H-pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 133102990 |
| Molecular Formula | C6H5F2N3O5S |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | 3-(difluoromethyl)-5-nitro-6-oxo-1H-pyridine-2-sulfonamide |
| SMILES | NS(=O)(=O)c1[nH]c(=O)c([N+](=O)[O-])cc1C(F)F |
| InChI | InChI=1S/C6H5F2N3O5S/c7-4(8)2-1-3(11(13)14)5(12)10-6(2)17(9,15)16/h1,4H,(H,10,12)(H2,9,15,16) |
| InChIKey | OGFXINMNFLDDCW-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 136.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|