C7H7F2N3O3 — CID 118802906
6-(aminomethyl)-5-(difluoromethyl)-3-nitro-1H-pyridin-2-one (PubChem CID 118802906) has the molecular formula C7H7F2N3O3 and a molecular weight of 219.15 g/mol. Its IUPAC name is 6-(aminomethyl)-5-(difluoromethyl)-3-nitro-1H-pyridin-2-one.
| Compound Name | 6-(aminomethyl)-5-(difluoromethyl)-3-nitro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118802906 |
| Molecular Formula | C7H7F2N3O3 |
| Molecular Weight | 219.15 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 6-(aminomethyl)-5-(difluoromethyl)-3-nitro-1H-pyridin-2-one |
| SMILES | NCc1[nH]c(=O)c([N+](=O)[O-])cc1C(F)F |
| InChI | InChI=1S/C7H7F2N3O3/c8-6(9)3-1-5(12(14)15)7(13)11-4(3)2-10/h1,6H,2,10H2,(H,11,13) |
| InChIKey | UJESESXMHOVQGY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.15 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|