C13H14N4O6 — CID 10426257
2-[methyl-[(6-methyl-7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]acetic acid (PubChem CID 10426257) has the molecular formula C13H14N4O6 and a molecular weight of 322.28 g/mol. Its IUPAC name is 2-[methyl-[(6-methyl-7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]acetic acid.
| Compound Name | 2-[methyl-[(6-methyl-7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 10426257 |
| Molecular Formula | C13H14N4O6 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-[methyl-[(6-methyl-7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]amino]acetic acid |
| SMILES | Cc1c([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c2c1CN(C)CC(=O)O |
| InChI | InChI=1S/C13H14N4O6/c1-6-7(4-16(2)5-10(18)19)11-8(3-9(6)17(22)23)14-12(20)13(21)15-11/h3H,4-5H2,1-2H3,(H,14,20)(H,15,21)(H,18,19) |
| InChIKey | RNOOEBQODFOTAH-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 149.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|