C20H21N5O5 — CID 21268087
3-(2,4-dimethylphenyl)-1-methyl-1-[(6-methyl-7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]urea (PubChem CID 21268087) has the molecular formula C20H21N5O5 and a molecular weight of 411.42 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-1-methyl-1-[(6-methyl-7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]urea.
| Compound Name | 3-(2,4-dimethylphenyl)-1-methyl-1-[(6-methyl-7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]urea |
|---|---|
| PubChem CID | 21268087 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-1-methyl-1-[(6-methyl-7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]urea |
| SMILES | Cc1ccc(NC(=O)N(C)Cc2c(C)c([N+](=O)[O-])cc3[nH]c(=O)c(=O)[nH]c23)c(C)c1 |
| InChI | InChI=1S/C20H21N5O5/c1-10-5-6-14(11(2)7-10)22-20(28)24(4)9-13-12(3)16(25(29)30)8-15-17(13)23-19(27)18(26)21-15/h5-8H,9H2,1-4H3,(H,21,26)(H,22,28)(H,23,27) |
| InChIKey | NGGOZPZXXWWTPE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 141.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|