C12H7N3O6S — CID 59364519
6-nitro-2,3-dioxo-1,4-dihydrobenzo[f]quinoxaline-7-sulfinic acid (PubChem CID 59364519) has the molecular formula C12H7N3O6S and a molecular weight of 321.27 g/mol. Its IUPAC name is 6-nitro-2,3-dioxo-1,4-dihydrobenzo[f]quinoxaline-7-sulfinic acid.
| Compound Name | 6-nitro-2,3-dioxo-1,4-dihydrobenzo[f]quinoxaline-7-sulfinic acid |
|---|---|
| PubChem CID | 59364519 |
| Molecular Formula | C12H7N3O6S |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 6-nitro-2,3-dioxo-1,4-dihydrobenzo[f]quinoxaline-7-sulfinic acid |
| SMILES | O=c1[nH]c2cc([N+](=O)[O-])c3c(S(=O)O)cccc3c2[nH]c1=O |
| InChI | InChI=1S/C12H7N3O6S/c16-11-12(17)14-10-5-2-1-3-8(22(20)21)9(5)7(15(18)19)4-6(10)13-11/h1-4H,(H,13,16)(H,14,17)(H,20,21) |
| InChIKey | ZHKHVCOJZIDMRY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 146.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|