About potassium;hydride;2-nitrobenzenesulfinic acid
potassium;hydride;2-nitrobenzenesulfinic acid (PubChem CID 173256156) has the molecular formula C6H6KNO4S
and a molecular weight of 227.28 g/mol. Its IUPAC name is potassium;hydride;2-nitrobenzenesulfinic acid.
Molecular Properties
| Compound Name | potassium;hydride;2-nitrobenzenesulfinic acid |
| PubChem CID | 173256156 |
| Molecular Formula | C6H6KNO4S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 226.97 |
| IUPAC Name | potassium;hydride;2-nitrobenzenesulfinic acid |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)O.[H-].[K+] |
| InChI | InChI=1S/C6H5NO4S.K.H/c8-7(9)5-3-1-2-4-6(5)12(10)11;;/h1-4H,(H,10,11);;/q;+1;-1 |
| InChIKey | HYSDWBHZJIMJKP-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;2-nitrobenzenesulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;2-nitrobenzenesulfinic acid?
The IUPAC name of potassium;hydride;2-nitrobenzenesulfinic acid (CID 173256156) is potassium;hydride;2-nitrobenzenesulfinic acid.
What is the SMILES notation for potassium;hydride;2-nitrobenzenesulfinic acid?
The canonical SMILES for potassium;hydride;2-nitrobenzenesulfinic acid is O=[N+]([O-])c1ccccc1S(=O)O.[H-].[K+].
What is the InChIKey of potassium;hydride;2-nitrobenzenesulfinic acid?
The InChIKey is HYSDWBHZJIMJKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO4S.K.H/c8-7(9)5-3-1-2-4-6(5)12(10)11;;/h1-4H,(H,10,11);;/q;+1;-1.
What are the key properties of potassium;hydride;2-nitrobenzenesulfinic acid?
potassium;hydride;2-nitrobenzenesulfinic acid has a molecular weight of 227.28 g/mol, XLogP of -1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;2-nitrobenzenesulfinic acid is sourced from PubChem (CID 173256156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).