C12H8N4O7S — CID 91140038
(6-nitro-2,3-dioxo-1,4-dihydrobenzo[f]quinoxalin-7-yl) sulfamate (PubChem CID 91140038) has the molecular formula C12H8N4O7S and a molecular weight of 352.28 g/mol. Its IUPAC name is (6-nitro-2,3-dioxo-1,4-dihydrobenzo[f]quinoxalin-7-yl) sulfamate.
| Compound Name | (6-nitro-2,3-dioxo-1,4-dihydrobenzo[f]quinoxalin-7-yl) sulfamate |
|---|---|
| PubChem CID | 91140038 |
| Molecular Formula | C12H8N4O7S |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | (6-nitro-2,3-dioxo-1,4-dihydrobenzo[f]quinoxalin-7-yl) sulfamate |
| SMILES | NS(=O)(=O)Oc1cccc2c1c([N+](=O)[O-])cc1[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C12H8N4O7S/c13-24(21,22)23-8-3-1-2-5-9(8)7(16(19)20)4-6-10(5)15-12(18)11(17)14-6/h1-4H,(H,14,17)(H,15,18)(H2,13,21,22) |
| InChIKey | HANVGJFKZFGOPW-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 178.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|