C12H10N4O10S2 — CID 91322656
[3-nitro-4-(2-nitro-4-sulfamoyloxyphenyl)phenyl] sulfamate (PubChem CID 91322656) has the molecular formula C12H10N4O10S2 and a molecular weight of 434.36 g/mol. Its IUPAC name is [3-nitro-4-(2-nitro-4-sulfamoyloxyphenyl)phenyl] sulfamate.
| Compound Name | [3-nitro-4-(2-nitro-4-sulfamoyloxyphenyl)phenyl] sulfamate |
|---|---|
| PubChem CID | 91322656 |
| Molecular Formula | C12H10N4O10S2 |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 433.98 |
| IUPAC Name | [3-nitro-4-(2-nitro-4-sulfamoyloxyphenyl)phenyl] sulfamate |
| SMILES | NS(=O)(=O)Oc1ccc(-c2ccc(OS(N)(=O)=O)cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H10N4O10S2/c13-27(21,22)25-7-1-3-9(11(5-7)15(17)18)10-4-2-8(26-28(14,23)24)6-12(10)16(19)20/h1-6H,(H2,13,21,22)(H2,14,23,24) |
| InChIKey | DNWAPMDWABBXTD-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 225.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|