C6H5NO6S — CID 174452895
2-nitrobicyclo[2.2.0]hexa-1,3,5-triene;sulfuric acid (PubChem CID 174452895) has the molecular formula C6H5NO6S and a molecular weight of 219.17 g/mol. Its IUPAC name is 2-nitrobicyclo[2.2.0]hexa-1,3,5-triene;sulfuric acid.
| Compound Name | 2-nitrobicyclo[2.2.0]hexa-1,3,5-triene;sulfuric acid |
|---|---|
| PubChem CID | 174452895 |
| Molecular Formula | C6H5NO6S |
| Molecular Weight | 219.17 g/mol |
| Exact Mass | 218.98 |
| IUPAC Name | 2-nitrobicyclo[2.2.0]hexa-1,3,5-triene;sulfuric acid |
| SMILES | O=S(=O)(O)O.O=[N+]([O-])c1cc2ccc1-2 |
| InChI | InChI=1S/C6H3NO2.H2O4S/c8-7(9)6-3-4-1-2-5(4)6;1-5(2,3)4/h1-3H;(H2,1,2,3,4) |
| InChIKey | UHGXBKFZLKWSJH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.17 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|