C12H7NO3 — CID 56622147
8-nitrotricyclo[5.2.2.12,6]dodeca-1(9),2(12),3,5,7,10-hexaen-4-ol (PubChem CID 56622147) has the molecular formula C12H7NO3 and a molecular weight of 213.19 g/mol. Its IUPAC name is 8-nitrotricyclo[5.2.2.12,6]dodeca-1(9),2(12),3,5,7,10-hexaen-4-ol.
| Compound Name | 8-nitrotricyclo[5.2.2.12,6]dodeca-1(9),2(12),3,5,7,10-hexaen-4-ol |
|---|---|
| PubChem CID | 56622147 |
| Molecular Formula | C12H7NO3 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 8-nitrotricyclo[5.2.2.12,6]dodeca-1(9),2(12),3,5,7,10-hexaen-4-ol |
| SMILES | O=[N+]([O-])c1cc2ccc1-c1cc(O)cc-2c1 |
| InChI | InChI=1S/C12H7NO3/c14-10-4-8-3-9(5-10)11-2-1-7(8)6-12(11)13(15)16/h1-6,14H |
| InChIKey | XKHZZGDQWPHGRL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|