C13H9N3O6S — CID 141330390
6-nitro-2,3-dioxo-1,4-dihydrobenzo[f]quinoline-7-sulfonamide (PubChem CID 141330390) has the molecular formula C13H9N3O6S and a molecular weight of 335.30 g/mol. Its IUPAC name is 6-nitro-2,3-dioxo-1,4-dihydrobenzo[f]quinoline-7-sulfonamide.
| Compound Name | 6-nitro-2,3-dioxo-1,4-dihydrobenzo[f]quinoline-7-sulfonamide |
|---|---|
| PubChem CID | 141330390 |
| Molecular Formula | C13H9N3O6S |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 6-nitro-2,3-dioxo-1,4-dihydrobenzo[f]quinoline-7-sulfonamide |
| SMILES | NS(=O)(=O)c1cccc2c3c(cc([N+](=O)[O-])c12)NC(=O)C(=O)C3 |
| InChI | InChI=1S/C13H9N3O6S/c14-23(21,22)11-3-1-2-6-7-4-10(17)13(18)15-8(7)5-9(12(6)11)16(19)20/h1-3,5H,4H2,(H,15,18)(H2,14,21,22) |
| InChIKey | YISYTSAAHSVDIT-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 149.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|