About iron(2+);bis(2-nitrobenzenesulfonate)
iron(2+);bis(2-nitrobenzenesulfonate) (PubChem CID 141179187) has the molecular formula C12H8FeN2O10S2
and a molecular weight of 460.18 g/mol. Its IUPAC name is iron(2+);bis(2-nitrobenzenesulfonate).
Molecular Properties
| Compound Name | iron(2+);bis(2-nitrobenzenesulfonate) |
| PubChem CID | 141179187 |
| Molecular Formula | C12H8FeN2O10S2 |
| Molecular Weight | 460.18 g/mol |
| Exact Mass | 459.90 |
| IUPAC Name | iron(2+);bis(2-nitrobenzenesulfonate) |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)[O-].O=[N+]([O-])c1ccccc1S(=O)(=O)[O-].[Fe+2] |
| InChI | InChI=1S/2C6H5NO5S.Fe/c2*8-7(9)5-3-1-2-4-6(5)13(10,11)12;/h2*1-4H,(H,10,11,12);/q;;+2/p-2 |
| InChIKey | AOYYZIKVRKKKHJ-UHFFFAOYSA-L |
| XLogP | 1.00 |
| TPSA | 200.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze iron(2+);bis(2-nitrobenzenesulfonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron(2+);bis(2-nitrobenzenesulfonate)?
The IUPAC name of iron(2+);bis(2-nitrobenzenesulfonate) (CID 141179187) is iron(2+);bis(2-nitrobenzenesulfonate).
What is the SMILES notation for iron(2+);bis(2-nitrobenzenesulfonate)?
The canonical SMILES for iron(2+);bis(2-nitrobenzenesulfonate) is O=[N+]([O-])c1ccccc1S(=O)(=O)[O-].O=[N+]([O-])c1ccccc1S(=O)(=O)[O-].[Fe+2].
What is the InChIKey of iron(2+);bis(2-nitrobenzenesulfonate)?
The InChIKey is AOYYZIKVRKKKHJ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H5NO5S.Fe/c2*8-7(9)5-3-1-2-4-6(5)13(10,11)12;/h2*1-4H,(H,10,11,12);/q;;+2/p-2.
What are the key properties of iron(2+);bis(2-nitrobenzenesulfonate)?
iron(2+);bis(2-nitrobenzenesulfonate) has a molecular weight of 460.18 g/mol, XLogP of 1.00, 4 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for iron(2+);bis(2-nitrobenzenesulfonate) is sourced from PubChem (CID 141179187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).