C7H3N5O6 — CID 10848460
6,7-dinitro-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 10848460) has the molecular formula C7H3N5O6 and a molecular weight of 253.13 g/mol. Its IUPAC name is 6,7-dinitro-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 6,7-dinitro-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 10848460 |
| Molecular Formula | C7H3N5O6 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 6,7-dinitro-1,4-dihydropyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | O=c1[nH]c2cc([N+](=O)[O-])c([N+](=O)[O-])nc2[nH]c1=O |
| InChI | InChI=1S/C7H3N5O6/c13-6-7(14)10-4-2(8-6)1-3(11(15)16)5(9-4)12(17)18/h1H,(H,8,13)(H,9,10,14) |
| InChIKey | GDBMNBXUUXVCIS-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 164.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|