C8H6N4O5 — CID 57021774
1-hydroxy-6-methyl-8-nitro-4H-pyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 57021774) has the molecular formula C8H6N4O5 and a molecular weight of 238.16 g/mol. Its IUPAC name is 1-hydroxy-6-methyl-8-nitro-4H-pyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 1-hydroxy-6-methyl-8-nitro-4H-pyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 57021774 |
| Molecular Formula | C8H6N4O5 |
| Molecular Weight | 238.16 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 1-hydroxy-6-methyl-8-nitro-4H-pyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | Cc1cc([N+](=O)[O-])c2c(n1)[nH]c(=O)c(=O)n2O |
| InChI | InChI=1S/C8H6N4O5/c1-3-2-4(12(16)17)5-6(9-3)10-7(13)8(14)11(5)15/h2,15H,1H3,(H,9,10,13) |
| InChIKey | XIYXTMCUJNYTJT-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.16 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|