C12H13BrN4O4 — CID 45262758
6-[(2-methylaziridin-1-yl)methyl]-7-nitro-1,4-dihydroquinoxaline-2,3-dione;hydrobromide (PubChem CID 45262758) has the molecular formula C12H13BrN4O4 and a molecular weight of 357.16 g/mol. Its IUPAC name is 6-[(2-methylaziridin-1-yl)methyl]-7-nitro-1,4-dihydroquinoxaline-2,3-dione;hydrobromide.
| Compound Name | 6-[(2-methylaziridin-1-yl)methyl]-7-nitro-1,4-dihydroquinoxaline-2,3-dione;hydrobromide |
|---|---|
| PubChem CID | 45262758 |
| Molecular Formula | C12H13BrN4O4 |
| Molecular Weight | 357.16 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 6-[(2-methylaziridin-1-yl)methyl]-7-nitro-1,4-dihydroquinoxaline-2,3-dione;hydrobromide |
| SMILES | Br.CC1CN1Cc1cc2[nH]c(=O)c(=O)[nH]c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N4O4.BrH/c1-6-4-15(6)5-7-2-8-9(3-10(7)16(19)20)14-12(18)11(17)13-8;/h2-3,6H,4-5H2,1H3,(H,13,17)(H,14,18);1H |
| InChIKey | OQXOZAQGGTVWHX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.16 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|