C14H15BrN4O4 — CID 45265463
6-(3,6-dihydro-2H-pyridin-1-ylmethyl)-7-nitro-1,4-dihydroquinoxaline-2,3-dione;hydrobromide (PubChem CID 45265463) has the molecular formula C14H15BrN4O4 and a molecular weight of 383.20 g/mol. Its IUPAC name is 6-(3,6-dihydro-2H-pyridin-1-ylmethyl)-7-nitro-1,4-dihydroquinoxaline-2,3-dione;hydrobromide.
| Compound Name | 6-(3,6-dihydro-2H-pyridin-1-ylmethyl)-7-nitro-1,4-dihydroquinoxaline-2,3-dione;hydrobromide |
|---|---|
| PubChem CID | 45265463 |
| Molecular Formula | C14H15BrN4O4 |
| Molecular Weight | 383.20 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 6-(3,6-dihydro-2H-pyridin-1-ylmethyl)-7-nitro-1,4-dihydroquinoxaline-2,3-dione;hydrobromide |
| SMILES | Br.O=c1[nH]c2cc(CN3CC=CCC3)c([N+](=O)[O-])cc2[nH]c1=O |
| InChI | InChI=1S/C14H14N4O4.BrH/c19-13-14(20)16-11-7-12(18(21)22)9(6-10(11)15-13)8-17-4-2-1-3-5-17;/h1-2,6-7H,3-5,8H2,(H,15,19)(H,16,20);1H |
| InChIKey | LSUZWHJKUFQRKH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 112.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|