C13H16N2O2 — CID 57092279
1-[2-(2-nitrophenyl)ethyl]-3,6-dihydro-2H-pyridine (PubChem CID 57092279) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-[2-(2-nitrophenyl)ethyl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[2-(2-nitrophenyl)ethyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 57092279 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 1-[2-(2-nitrophenyl)ethyl]-3,6-dihydro-2H-pyridine |
| SMILES | O=[N+]([O-])c1ccccc1CCN1CC=CCC1 |
| InChI | InChI=1S/C13H16N2O2/c16-15(17)13-7-3-2-6-12(13)8-11-14-9-4-1-5-10-14/h1-4,6-7H,5,8-11H2 |
| InChIKey | FZRJKSKOHATMMB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|