C15H18N4O7S — CID 151072726
6-[1-(2-hydroxyethyl)piperidin-4-yl]sulfonyl-7-nitro-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 151072726) has the molecular formula C15H18N4O7S and a molecular weight of 398.40 g/mol. Its IUPAC name is 6-[1-(2-hydroxyethyl)piperidin-4-yl]sulfonyl-7-nitro-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[1-(2-hydroxyethyl)piperidin-4-yl]sulfonyl-7-nitro-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 151072726 |
| Molecular Formula | C15H18N4O7S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 6-[1-(2-hydroxyethyl)piperidin-4-yl]sulfonyl-7-nitro-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2cc([N+](=O)[O-])c(S(=O)(=O)C3CCN(CCO)CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C15H18N4O7S/c20-6-5-18-3-1-9(2-4-18)27(25,26)13-8-11-10(7-12(13)19(23)24)16-14(21)15(22)17-11/h7-9,20H,1-6H2,(H,16,21)(H,17,22) |
| InChIKey | MILXHDXIZODHAX-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 166.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|