C15H17N3O6S — CID 22097197
4-cyclohexyl-7-methylsulfonyl-6-nitro-1H-quinoxaline-2,3-dione (PubChem CID 22097197) has the molecular formula C15H17N3O6S and a molecular weight of 367.38 g/mol. Its IUPAC name is 4-cyclohexyl-7-methylsulfonyl-6-nitro-1H-quinoxaline-2,3-dione.
| Compound Name | 4-cyclohexyl-7-methylsulfonyl-6-nitro-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 22097197 |
| Molecular Formula | C15H17N3O6S |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 4-cyclohexyl-7-methylsulfonyl-6-nitro-1H-quinoxaline-2,3-dione |
| SMILES | CS(=O)(=O)c1cc2[nH]c(=O)c(=O)n(C3CCCCC3)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N3O6S/c1-25(23,24)13-7-10-11(8-12(13)18(21)22)17(15(20)14(19)16-10)9-5-3-2-4-6-9/h7-9H,2-6H2,1H3,(H,16,19) |
| InChIKey | AVOSUEIMNJTOMW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|