C26H26N6O5 — CID 22100084
1-[[1-(4-cyclohexyl-7-nitro-2,3-dioxo-1H-quinoxalin-6-yl)pyrrol-3-yl]methyl]-3-phenylurea (PubChem CID 22100084) has the molecular formula C26H26N6O5 and a molecular weight of 502.53 g/mol. Its IUPAC name is 1-[[1-(4-cyclohexyl-7-nitro-2,3-dioxo-1H-quinoxalin-6-yl)pyrrol-3-yl]methyl]-3-phenylurea.
| Compound Name | 1-[[1-(4-cyclohexyl-7-nitro-2,3-dioxo-1H-quinoxalin-6-yl)pyrrol-3-yl]methyl]-3-phenylurea |
|---|---|
| PubChem CID | 22100084 |
| Molecular Formula | C26H26N6O5 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 1-[[1-(4-cyclohexyl-7-nitro-2,3-dioxo-1H-quinoxalin-6-yl)pyrrol-3-yl]methyl]-3-phenylurea |
| SMILES | O=C(NCc1ccn(-c2cc3c(cc2[N+](=O)[O-])[nH]c(=O)c(=O)n3C2CCCCC2)c1)Nc1ccccc1 |
| InChI | InChI=1S/C26H26N6O5/c33-24-25(34)31(19-9-5-2-6-10-19)21-14-22(23(32(36)37)13-20(21)29-24)30-12-11-17(16-30)15-27-26(35)28-18-7-3-1-4-8-18/h1,3-4,7-8,11-14,16,19H,2,5-6,9-10,15H2,(H,29,33)(H2,27,28,35) |
| InChIKey | VMAPXVKYAVCBKQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 144.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|