C24H21N5O7 — CID 22449294
ethyl 2-[7-[3-(benzylcarbamoyl)pyrrol-1-yl]-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl]acetate (PubChem CID 22449294) has the molecular formula C24H21N5O7 and a molecular weight of 491.46 g/mol. Its IUPAC name is ethyl 2-[7-[3-(benzylcarbamoyl)pyrrol-1-yl]-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl]acetate.
| Compound Name | ethyl 2-[7-[3-(benzylcarbamoyl)pyrrol-1-yl]-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl]acetate |
|---|---|
| PubChem CID | 22449294 |
| Molecular Formula | C24H21N5O7 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | ethyl 2-[7-[3-(benzylcarbamoyl)pyrrol-1-yl]-6-nitro-2,3-dioxo-4H-quinoxalin-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(=O)c(=O)[nH]c2cc([N+](=O)[O-])c(-n3ccc(C(=O)NCc4ccccc4)c3)cc21 |
| InChI | InChI=1S/C24H21N5O7/c1-2-36-21(30)14-28-18-11-19(20(29(34)35)10-17(18)26-23(32)24(28)33)27-9-8-16(13-27)22(31)25-12-15-6-4-3-5-7-15/h3-11,13H,2,12,14H2,1H3,(H,25,31)(H,26,32) |
| InChIKey | RPMNDSABAXPUBI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 158.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|