C29H22F3N5O4 — CID 67665383
N-benzyl-1-[4-[(2-methylbenzoyl)amino]-2,3-dioxo-7-(trifluoromethyl)-1H-quinoxalin-6-yl]pyrrole-3-carboxamide (PubChem CID 67665383) has the molecular formula C29H22F3N5O4 and a molecular weight of 561.52 g/mol. Its IUPAC name is N-benzyl-1-[4-[(2-methylbenzoyl)amino]-2,3-dioxo-7-(trifluoromethyl)-1H-quinoxalin-6-yl]pyrrole-3-carboxamide.
| Compound Name | N-benzyl-1-[4-[(2-methylbenzoyl)amino]-2,3-dioxo-7-(trifluoromethyl)-1H-quinoxalin-6-yl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 67665383 |
| Molecular Formula | C29H22F3N5O4 |
| Molecular Weight | 561.52 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | N-benzyl-1-[4-[(2-methylbenzoyl)amino]-2,3-dioxo-7-(trifluoromethyl)-1H-quinoxalin-6-yl]pyrrole-3-carboxamide |
| SMILES | Cc1ccccc1C(=O)Nn1c(=O)c(=O)[nH]c2cc(C(F)(F)F)c(-n3ccc(C(=O)NCc4ccccc4)c3)cc21 |
| InChI | InChI=1S/C29H22F3N5O4/c1-17-7-5-6-10-20(17)26(39)35-37-24-14-23(21(29(30,31)32)13-22(24)34-27(40)28(37)41)36-12-11-19(16-36)25(38)33-15-18-8-3-2-4-9-18/h2-14,16H,15H2,1H3,(H,33,38)(H,34,40)(H,35,39) |
| InChIKey | NXQMITJLENEQFZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|