C20H19F3N4O5 — CID 22097100
ethyl 2-[7-[3-(acetamidomethyl)pyrrol-1-yl]-2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]acetate (PubChem CID 22097100) has the molecular formula C20H19F3N4O5 and a molecular weight of 452.39 g/mol. Its IUPAC name is ethyl 2-[7-[3-(acetamidomethyl)pyrrol-1-yl]-2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]acetate.
| Compound Name | ethyl 2-[7-[3-(acetamidomethyl)pyrrol-1-yl]-2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]acetate |
|---|---|
| PubChem CID | 22097100 |
| Molecular Formula | C20H19F3N4O5 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | ethyl 2-[7-[3-(acetamidomethyl)pyrrol-1-yl]-2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(=O)c(=O)[nH]c2cc(C(F)(F)F)c(-n3ccc(CNC(C)=O)c3)cc21 |
| InChI | InChI=1S/C20H19F3N4O5/c1-3-32-17(29)10-27-16-7-15(26-5-4-12(9-26)8-24-11(2)28)13(20(21,22)23)6-14(16)25-18(30)19(27)31/h4-7,9H,3,8,10H2,1-2H3,(H,24,28)(H,25,30) |
| InChIKey | LKEMBEXKUFWPHR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|