C16H14N2O4 — CID 67641154
ethyl 2-(2,3-dioxo-1H-benzo[f]quinoxalin-4-yl)acetate (PubChem CID 67641154) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is ethyl 2-(2,3-dioxo-1H-benzo[f]quinoxalin-4-yl)acetate.
| Compound Name | ethyl 2-(2,3-dioxo-1H-benzo[f]quinoxalin-4-yl)acetate |
|---|---|
| PubChem CID | 67641154 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | ethyl 2-(2,3-dioxo-1H-benzo[f]quinoxalin-4-yl)acetate |
| SMILES | CCOC(=O)Cn1c(=O)c(=O)[nH]c2c3ccccc3ccc21 |
| InChI | InChI=1S/C16H14N2O4/c1-2-22-13(19)9-18-12-8-7-10-5-3-4-6-11(10)14(12)17-15(20)16(18)21/h3-8H,2,9H2,1H3,(H,17,20) |
| InChIKey | KGWCZNXPLUKCOW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|