C23H21N3O4 — CID 86690019
tert-butyl N-[4-(2,3-dioxo-1H-benzo[f]quinoxalin-4-yl)phenyl]carbamate (PubChem CID 86690019) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is tert-butyl N-[4-(2,3-dioxo-1H-benzo[f]quinoxalin-4-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(2,3-dioxo-1H-benzo[f]quinoxalin-4-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 86690019 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | tert-butyl N-[4-(2,3-dioxo-1H-benzo[f]quinoxalin-4-yl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-n2c(=O)c(=O)[nH]c3c4ccccc4ccc32)cc1 |
| InChI | InChI=1S/C23H21N3O4/c1-23(2,3)30-22(29)24-15-9-11-16(12-10-15)26-18-13-8-14-6-4-5-7-17(14)19(18)25-20(27)21(26)28/h4-13H,1-3H3,(H,24,29)(H,25,27) |
| InChIKey | IAMYHAQTMFXQHH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|