C19H20N4O3S — CID 70975898
tert-butyl N-[4-(3-amino-4-oxophthalazin-1-yl)sulfanylphenyl]carbamate (PubChem CID 70975898) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is tert-butyl N-[4-(3-amino-4-oxophthalazin-1-yl)sulfanylphenyl]carbamate.
| Compound Name | tert-butyl N-[4-(3-amino-4-oxophthalazin-1-yl)sulfanylphenyl]carbamate |
|---|---|
| PubChem CID | 70975898 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | tert-butyl N-[4-(3-amino-4-oxophthalazin-1-yl)sulfanylphenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Sc2nn(N)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C19H20N4O3S/c1-19(2,3)26-18(25)21-12-8-10-13(11-9-12)27-16-14-6-4-5-7-15(14)17(24)23(20)22-16/h4-11H,20H2,1-3H3,(H,21,25) |
| InChIKey | MNSSMOUAUXHLOU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |