C12H17N3O2 — CID 140873567
tert-butyl N-[4-[(E)-hydrazinylidenemethyl]phenyl]carbamate (PubChem CID 140873567) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is tert-butyl N-[4-[(E)-hydrazinylidenemethyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(E)-hydrazinylidenemethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 140873567 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | tert-butyl N-[4-[(E)-hydrazinylidenemethyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(/C=N/N)cc1 |
| InChI | InChI=1S/C12H17N3O2/c1-12(2,3)17-11(16)15-10-6-4-9(5-7-10)8-14-13/h4-8H,13H2,1-3H3,(H,15,16)/b14-8+ |
| InChIKey | NBNZSRMOBMHZGU-RIYZIHGNSA-N |
| XLogP | 2.33 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|