C21H26N4O2S — CID 175057023
tert-butyl N-[4-[[carbamothioyl-(2,6-dimethylphenyl)hydrazinylidene]methyl]phenyl]carbamate (PubChem CID 175057023) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is tert-butyl N-[4-[[carbamothioyl-(2,6-dimethylphenyl)hydrazinylidene]methyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[carbamothioyl-(2,6-dimethylphenyl)hydrazinylidene]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 175057023 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | tert-butyl N-[4-[[carbamothioyl-(2,6-dimethylphenyl)hydrazinylidene]methyl]phenyl]carbamate |
| SMILES | Cc1cccc(C)c1N(N=Cc1ccc(NC(=O)OC(C)(C)C)cc1)C(N)=S |
| InChI | InChI=1S/C21H26N4O2S/c1-14-7-6-8-15(2)18(14)25(19(22)28)23-13-16-9-11-17(12-10-16)24-20(26)27-21(3,4)5/h6-13H,1-5H3,(H2,22,28)(H,24,26) |
| InChIKey | UDMFXWZLGOJKAV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|