C20H22N2O3 — CID 154644634
tert-butyl N-[4-[(E)-3-(3-methyl-2-pyridinyl)-3-oxoprop-1-enyl]phenyl]carbamate (PubChem CID 154644634) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is tert-butyl N-[4-[(E)-3-(3-methyl-2-pyridinyl)-3-oxoprop-1-enyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(E)-3-(3-methyl-2-pyridinyl)-3-oxoprop-1-enyl]phenyl]carbamate |
|---|---|
| PubChem CID | 154644634 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | tert-butyl N-[4-[(E)-3-(3-methyl-2-pyridinyl)-3-oxoprop-1-enyl]phenyl]carbamate |
| SMILES | Cc1cccnc1C(=O)/C=C/c1ccc(NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H22N2O3/c1-14-6-5-13-21-18(14)17(23)12-9-15-7-10-16(11-8-15)22-19(24)25-20(2,3)4/h5-13H,1-4H3,(H,22,24)/b12-9+ |
| InChIKey | YCTMFLRHFKIRBG-FMIVXFBMSA-N |
| XLogP | 4.63 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|