C30H36N2O4 — CID 102416606
tert-butyl N-[4-[6-[4-[(E)-2-pyridin-2-ylethenyl]phenoxy]hexoxy]phenyl]carbamate (PubChem CID 102416606) has the molecular formula C30H36N2O4 and a molecular weight of 488.63 g/mol. Its IUPAC name is tert-butyl N-[4-[6-[4-[(E)-2-pyridin-2-ylethenyl]phenoxy]hexoxy]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[6-[4-[(E)-2-pyridin-2-ylethenyl]phenoxy]hexoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 102416606 |
| Molecular Formula | C30H36N2O4 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | tert-butyl N-[4-[6-[4-[(E)-2-pyridin-2-ylethenyl]phenoxy]hexoxy]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(OCCCCCCOc2ccc(/C=C/c3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C30H36N2O4/c1-30(2,3)36-29(33)32-26-15-19-28(20-16-26)35-23-9-5-4-8-22-34-27-17-12-24(13-18-27)11-14-25-10-6-7-21-31-25/h6-7,10-21H,4-5,8-9,22-23H2,1-3H3,(H,32,33)/b14-11+ |
| InChIKey | OWZHWJFHUNUYMX-SDNWHVSQSA-N |
| XLogP | 7.62 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|