C19H17F2N3O4 — CID 24777989
tert-butyl N-[4-(6,7-difluoro-2,4-dioxo-1H-quinazolin-3-yl)phenyl]carbamate (PubChem CID 24777989) has the molecular formula C19H17F2N3O4 and a molecular weight of 389.36 g/mol. Its IUPAC name is tert-butyl N-[4-(6,7-difluoro-2,4-dioxo-1H-quinazolin-3-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(6,7-difluoro-2,4-dioxo-1H-quinazolin-3-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 24777989 |
| Molecular Formula | C19H17F2N3O4 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | tert-butyl N-[4-(6,7-difluoro-2,4-dioxo-1H-quinazolin-3-yl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-n2c(=O)[nH]c3cc(F)c(F)cc3c2=O)cc1 |
| InChI | InChI=1S/C19H17F2N3O4/c1-19(2,3)28-18(27)22-10-4-6-11(7-5-10)24-16(25)12-8-13(20)14(21)9-15(12)23-17(24)26/h4-9H,1-3H3,(H,22,27)(H,23,26) |
| InChIKey | MTXRLJCAOYKSEE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |