C20H14ClFN5O5S2- — CID 136649274
N'-(5-chlorothiophen-2-yl)sulfonyl-N-[4-[6-fluoro-7-(methylamino)-2,4-dioxo-1H-quinazolin-3-yl]phenyl]carbamimidate (PubChem CID 136649274) has the molecular formula C20H14ClFN5O5S2- and a molecular weight of 522.95 g/mol. Its IUPAC name is N'-(5-chlorothiophen-2-yl)sulfonyl-N-[4-[6-fluoro-7-(methylamino)-2,4-dioxo-1H-quinazolin-3-yl]phenyl]carbamimidate.
| Compound Name | N'-(5-chlorothiophen-2-yl)sulfonyl-N-[4-[6-fluoro-7-(methylamino)-2,4-dioxo-1H-quinazolin-3-yl]phenyl]carbamimidate |
|---|---|
| PubChem CID | 136649274 |
| Molecular Formula | C20H14ClFN5O5S2- |
| Molecular Weight | 522.95 g/mol |
| Exact Mass | 522.01 |
| IUPAC Name | N'-(5-chlorothiophen-2-yl)sulfonyl-N-[4-[6-fluoro-7-(methylamino)-2,4-dioxo-1H-quinazolin-3-yl]phenyl]carbamimidate |
| SMILES | CNc1cc2[nH]c(=O)n(-c3ccc(NC([O-])=NS(=O)(=O)c4ccc(Cl)s4)cc3)c(=O)c2cc1F |
| InChI | InChI=1S/C20H15ClFN5O5S2/c1-23-15-9-14-12(8-13(15)22)18(28)27(20(30)25-14)11-4-2-10(3-5-11)24-19(29)26-34(31,32)17-7-6-16(21)33-17/h2-9,23H,1H3,(H,25,30)(H2,24,26,29)/p-1 |
| InChIKey | LGSDFTPAICUONK-UHFFFAOYSA-M |
| XLogP | 2.09 |
| TPSA | 148.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.95 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|