C25H26FN5O4S — CID 143459285
2,5-dimethylthiophene;ethenone;1-[4-[6-fluoro-7-(methylamino)-2,4-dioxo-1H-quinazolin-3-yl]phenyl]-3-methylurea (PubChem CID 143459285) has the molecular formula C25H26FN5O4S and a molecular weight of 511.58 g/mol. Its IUPAC name is 2,5-dimethylthiophene;ethenone;1-[4-[6-fluoro-7-(methylamino)-2,4-dioxo-1H-quinazolin-3-yl]phenyl]-3-methylurea.
| Compound Name | 2,5-dimethylthiophene;ethenone;1-[4-[6-fluoro-7-(methylamino)-2,4-dioxo-1H-quinazolin-3-yl]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 143459285 |
| Molecular Formula | C25H26FN5O4S |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 2,5-dimethylthiophene;ethenone;1-[4-[6-fluoro-7-(methylamino)-2,4-dioxo-1H-quinazolin-3-yl]phenyl]-3-methylurea |
| SMILES | C=C=O.CNC(=O)Nc1ccc(-n2c(=O)[nH]c3cc(NC)c(F)cc3c2=O)cc1.Cc1ccc(C)s1 |
| InChI | InChI=1S/C17H16FN5O3.C6H8S.C2H2O/c1-19-14-8-13-11(7-12(14)18)15(24)23(17(26)22-13)10-5-3-9(4-6-10)21-16(25)20-2;1-5-3-4-6(2)7-5;1-2-3/h3-8,19H,1-2H3,(H,22,26)(H2,20,21,25);3-4H,1-2H3;1H2 |
| InChIKey | OIBBHHKQVWKDEX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|