C26H17ClF3N5O5S2 — CID 11273671
1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[2,4-dioxo-7-[(3,4,5-trifluorophenyl)methylamino]-1H-quinazolin-3-yl]phenyl]urea (PubChem CID 11273671) has the molecular formula C26H17ClF3N5O5S2 and a molecular weight of 636.03 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[2,4-dioxo-7-[(3,4,5-trifluorophenyl)methylamino]-1H-quinazolin-3-yl]phenyl]urea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[2,4-dioxo-7-[(3,4,5-trifluorophenyl)methylamino]-1H-quinazolin-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 11273671 |
| Molecular Formula | C26H17ClF3N5O5S2 |
| Molecular Weight | 636.03 g/mol |
| Exact Mass | 635.03 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[2,4-dioxo-7-[(3,4,5-trifluorophenyl)methylamino]-1H-quinazolin-3-yl]phenyl]urea |
| SMILES | O=C(Nc1ccc(-n2c(=O)[nH]c3cc(NCc4cc(F)c(F)c(F)c4)ccc3c2=O)cc1)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C26H17ClF3N5O5S2/c27-21-7-8-22(41-21)42(39,40)34-25(37)32-14-1-4-16(5-2-14)35-24(36)17-6-3-15(11-20(17)33-26(35)38)31-12-13-9-18(28)23(30)19(29)10-13/h1-11,31H,12H2,(H,33,38)(H2,32,34,37) |
| InChIKey | FLYBCDJZAYVMNH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.03 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|