C24H17ClN6O8S2 — CID 21056484
1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[7-[(5-nitrofuran-2-yl)methylamino]-2,4-dioxo-1H-quinazolin-3-yl]phenyl]urea (PubChem CID 21056484) has the molecular formula C24H17ClN6O8S2 and a molecular weight of 617.02 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[7-[(5-nitrofuran-2-yl)methylamino]-2,4-dioxo-1H-quinazolin-3-yl]phenyl]urea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[7-[(5-nitrofuran-2-yl)methylamino]-2,4-dioxo-1H-quinazolin-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 21056484 |
| Molecular Formula | C24H17ClN6O8S2 |
| Molecular Weight | 617.02 g/mol |
| Exact Mass | 616.02 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[4-[7-[(5-nitrofuran-2-yl)methylamino]-2,4-dioxo-1H-quinazolin-3-yl]phenyl]urea |
| SMILES | O=C(Nc1ccc(-n2c(=O)[nH]c3cc(NCc4ccc([N+](=O)[O-])o4)ccc3c2=O)cc1)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C24H17ClN6O8S2/c25-19-8-10-21(40-19)41(37,38)29-23(33)27-13-1-4-15(5-2-13)30-22(32)17-7-3-14(11-18(17)28-24(30)34)26-12-16-6-9-20(39-16)31(35)36/h1-11,26H,12H2,(H,28,34)(H2,27,29,33) |
| InChIKey | NALLIFFZXYZIOO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 198.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.02 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|