C25H26ClN7O6S2 — CID 20799979
1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-[7-(3-morpholin-4-ylpropylamino)-2,4-dioxo-1H-quinazolin-3-yl]-3-pyridinyl]urea (PubChem CID 20799979) has the molecular formula C25H26ClN7O6S2 and a molecular weight of 620.11 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-[7-(3-morpholin-4-ylpropylamino)-2,4-dioxo-1H-quinazolin-3-yl]-3-pyridinyl]urea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-[7-(3-morpholin-4-ylpropylamino)-2,4-dioxo-1H-quinazolin-3-yl]-3-pyridinyl]urea |
|---|---|
| PubChem CID | 20799979 |
| Molecular Formula | C25H26ClN7O6S2 |
| Molecular Weight | 620.11 g/mol |
| Exact Mass | 619.11 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-[6-[7-(3-morpholin-4-ylpropylamino)-2,4-dioxo-1H-quinazolin-3-yl]-3-pyridinyl]urea |
| SMILES | O=C(Nc1ccc(-n2c(=O)[nH]c3cc(NCCCN4CCOCC4)ccc3c2=O)nc1)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C25H26ClN7O6S2/c26-20-5-7-22(40-20)41(37,38)31-24(35)29-17-3-6-21(28-15-17)33-23(34)18-4-2-16(14-19(18)30-25(33)36)27-8-1-9-32-10-12-39-13-11-32/h2-7,14-15,27H,1,8-13H2,(H,30,36)(H2,29,31,35) |
| InChIKey | JSKKHAFZIWNRBV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 167.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.11 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|